C17H14F3N3O2 — CID 70286659
2-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1H-triazolo[1,5-a]quinolin-10-ium-3-one hydroxide (PubChem CID 70286659) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1H-triazolo[1,5-a]quinolin-10-ium-3-one hydroxide.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1H-triazolo[1,5-a]quinolin-10-ium-3-one hydroxide |
|---|---|
| PubChem CID | 70286659 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1H-triazolo[1,5-a]quinolin-10-ium-3-one hydroxide |
| SMILES | O=c1c2[n+]([nH]n1-c1cccc(C(F)(F)F)c1)-c1ccccc1CC2.[OH-] |
| InChI | InChI=1S/C17H12F3N3O.H2O/c18-17(19,20)12-5-3-6-13(10-12)22-16(24)15-9-8-11-4-1-2-7-14(11)23(15)21-22;/h1-7,10H,8-9H2;1H2 |
| InChIKey | XCPADTYDVXXXOW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|