C14H25N3O5 — CID 70289496
1-[(2S,5S)-3,4-dihydroxy-5-[(pentylamino)methyl]oxolan-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 70289496) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[(2S,5S)-3,4-dihydroxy-5-[(pentylamino)methyl]oxolan-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(2S,5S)-3,4-dihydroxy-5-[(pentylamino)methyl]oxolan-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 70289496 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-[(2S,5S)-3,4-dihydroxy-5-[(pentylamino)methyl]oxolan-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | CCCCCNC[C@@H]1O[C@H](N2CCC(=O)NC2=O)C(O)C1O |
| InChI | InChI=1S/C14H25N3O5/c1-2-3-4-6-15-8-9-11(19)12(20)13(22-9)17-7-5-10(18)16-14(17)21/h9,11-13,15,19-20H,2-8H2,1H3,(H,16,18,21)/t9-,11?,12?,13-/m0/s1 |
| InChIKey | MFYSWHMTTBKUAP-ZIUBGBMXSA-N |
| XLogP | -0.85 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|