C16H22N4O11 — CID 71156791
2-[3-[[(2S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propanoylamino]butanedioic acid (PubChem CID 71156791) has the molecular formula C16H22N4O11 and a molecular weight of 446.37 g/mol. Its IUPAC name is 2-[3-[[(2S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propanoylamino]butanedioic acid.
| Compound Name | 2-[3-[[(2S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 71156791 |
| Molecular Formula | C16H22N4O11 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[3-[[(2S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propanoylamino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)CCNC(=O)[C@H]1O[C@@H](N2CCC(=O)NC2=O)[C@H](O)C1O)C(=O)O |
| InChI | InChI=1S/C16H22N4O11/c21-7(18-6(15(28)29)5-9(23)24)1-3-17-13(27)12-10(25)11(26)14(31-12)20-4-2-8(22)19-16(20)30/h6,10-12,14,25-26H,1-5H2,(H,17,27)(H,18,21)(H,23,24)(H,28,29)(H,19,22,30)/t6?,10?,11-,12+,14-/m1/s1 |
| InChIKey | HLPZWYNKSWWNME-XCPSBYQMSA-N |
| XLogP | -4.07 |
| TPSA | 231.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |