C21H25Cl2NO3 — CID 70291265
1-(2,4-dichlorophenyl)-3-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-2-one (PubChem CID 70291265) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-2-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-2-one |
|---|---|
| PubChem CID | 70291265 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-2-one |
| SMILES | CCCNCC(O)COc1ccccc1CC(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2NO3/c1-2-9-24-13-19(26)14-27-21-6-4-3-5-16(21)11-18(25)10-15-7-8-17(22)12-20(15)23/h3-8,12,19,24,26H,2,9-11,13-14H2,1H3 |
| InChIKey | YZGNCBZLNXAVFU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|