C9H12O3S — CID 70292464
1-(2-hydroxyethyl)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 70292464) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70292464 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-(2-hydroxyethyl)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1CC2C=CC1(CCO)S2 |
| InChI | InChI=1S/C9H12O3S/c10-4-3-9-2-1-6(13-9)5-7(9)8(11)12/h1-2,6-7,10H,3-5H2,(H,11,12) |
| InChIKey | JVAQNIVRWGAIFW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|