C28H29ClN6O3 — CID 70293976
7-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 70293976) has the molecular formula C28H29ClN6O3 and a molecular weight of 533.03 g/mol. Its IUPAC name is 7-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 7-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 70293976 |
| Molecular Formula | C28H29ClN6O3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 7-[4-(aminomethyl)-4-(3-chlorophenyl)cyclohexyl]-3-[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | COc1ccc(-c2cc(-c3nnc4n3CCN(C3CCC(CN)(c5cccc(Cl)c5)CC3)C4=O)on2)cc1 |
| InChI | InChI=1S/C28H29ClN6O3/c1-37-22-7-5-18(6-8-22)23-16-24(38-33-23)25-31-32-26-27(36)34(13-14-35(25)26)21-9-11-28(17-30,12-10-21)19-3-2-4-20(29)15-19/h2-8,15-16,21H,9-14,17,30H2,1H3 |
| InChIKey | CAJVMYZNGSLQEF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |