About (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide
(2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide (PubChem CID 70296506) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide |
| PubChem CID | 70296506 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide |
| SMILES | CCC/C=C\[C@@H]1C[C@H]1NC(=O)[C@@H]1CCCN1C(=O)CCC |
| InChI | InChI=1S/C17H28N2O2/c1-3-5-6-9-13-12-14(13)18-17(21)15-10-7-11-19(15)16(20)8-4-2/h6,9,13-15H,3-5,7-8,10-12H2,1-2H3,(H,18,21)/b9-6-/t13-,14-,15+/m1/s1 |
| InChIKey | OIBSDLJFGUMURO-QEFWPAOCSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide (CID 70296506) is (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide is CCC/C=C\[C@@H]1C[C@H]1NC(=O)[C@@H]1CCCN1C(=O)CCC.
What is the InChIKey of (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide?
The InChIKey is OIBSDLJFGUMURO-QEFWPAOCSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-3-5-6-9-13-12-14(13)18-17(21)15-10-7-11-19(15)16(20)8-4-2/h6,9,13-15H,3-5,7-8,10-12H2,1-2H3,(H,18,21)/b9-6-/t13-,14-,15+/m1/s1.
What are the key properties of (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide?
(2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide has a molecular weight of 292.42 g/mol, XLogP of 2.64, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 70296506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).