C17H28N2O2 — CID 70296506
(2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide (PubChem CID 70296506) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70296506 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2S)-1-butanoyl-N-[(1R,2S)-2-[(Z)-pent-1-enyl]cyclopropyl]pyrrolidine-2-carboxamide |
| SMILES | CCC/C=C\[C@@H]1C[C@H]1NC(=O)[C@@H]1CCCN1C(=O)CCC |
| InChI | InChI=1S/C17H28N2O2/c1-3-5-6-9-13-12-14(13)18-17(21)15-10-7-11-19(15)16(20)8-4-2/h6,9,13-15H,3-5,7-8,10-12H2,1-2H3,(H,18,21)/b9-6-/t13-,14-,15+/m1/s1 |
| InChIKey | OIBSDLJFGUMURO-QEFWPAOCSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|