C25H23N5O6S — CID 70298472
10-[[2-(2-amino-3,4-dioxocyclobutyl)-3,4-dihydro-1H-isoquinolin-7-yl]methylcarbamoyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-4-carboxylic acid (PubChem CID 70298472) has the molecular formula C25H23N5O6S and a molecular weight of 521.56 g/mol. Its IUPAC name is 10-[[2-(2-amino-3,4-dioxocyclobutyl)-3,4-dihydro-1H-isoquinolin-7-yl]methylcarbamoyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-4-carboxylic acid.
| Compound Name | 10-[[2-(2-amino-3,4-dioxocyclobutyl)-3,4-dihydro-1H-isoquinolin-7-yl]methylcarbamoyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 70298472 |
| Molecular Formula | C25H23N5O6S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 10-[[2-(2-amino-3,4-dioxocyclobutyl)-3,4-dihydro-1H-isoquinolin-7-yl]methylcarbamoyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-4-carboxylic acid |
| SMILES | NC1C(=O)C(=O)C1N1CCc2ccc(CNC(=O)c3nc4sc5c(c4c(=O)[nH]3)CC(C(=O)O)C5)cc2C1 |
| InChI | InChI=1S/C25H23N5O6S/c26-17-18(20(32)19(17)31)30-4-3-11-2-1-10(5-13(11)9-30)8-27-23(34)21-28-22(33)16-14-6-12(25(35)36)7-15(14)37-24(16)29-21/h1-2,5,12,17-18H,3-4,6-9,26H2,(H,27,34)(H,35,36)(H,28,29,33) |
| InChIKey | BHYAAINTWKAVKY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 175.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|