About [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate
[4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate (PubChem CID 70304294) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate |
| PubChem CID | 70304294 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate |
| SMILES | C/C=C\c1ccc(OC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C16H14O3/c1-2-5-12-8-10-13(11-9-12)19-16(18)14-6-3-4-7-15(14)17/h2-11,17H,1H3/b5-2- |
| InChIKey | NORUOMLCLAGATK-DJWKRKHSSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate?
The IUPAC name of [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate (CID 70304294) is [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate.
What is the SMILES notation for [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate?
The canonical SMILES for [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate is C/C=C\c1ccc(OC(=O)c2ccccc2O)cc1.
What is the InChIKey of [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate?
The InChIKey is NORUOMLCLAGATK-DJWKRKHSSA-N. The full InChI is InChI=1S/C16H14O3/c1-2-5-12-8-10-13(11-9-12)19-16(18)14-6-3-4-7-15(14)17/h2-11,17H,1H3/b5-2-.
What are the key properties of [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate?
[4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate has a molecular weight of 254.28 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(Z)-prop-1-enyl]phenyl] 2-hydroxybenzoate is sourced from PubChem (CID 70304294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).