C23H21F3N2O3 — CID 70304377
(4R,4aR,7S,7aR,12bS)-3-methyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol (PubChem CID 70304377) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
|---|---|
| PubChem CID | 70304377 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](Oc2ccc(C(F)(F)F)cn2)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H21F3N2O3/c1-28-9-8-22-14-4-6-17(30-18-7-3-13(11-27-18)23(24,25)26)21(22)31-20-16(29)5-2-12(19(20)22)10-15(14)28/h2-7,11,14-15,17,21,29H,8-10H2,1H3/t14-,15+,17-,21-,22-/m0/s1 |
| InChIKey | QLVHMFZHKJYSQY-CLTUZACYSA-N |
| XLogP | 3.70 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|