C17H19NO2S — CID 70308009
2-(5-ethylcyclohexen-1-yl)-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 70308009) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-(5-ethylcyclohexen-1-yl)-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | 2-(5-ethylcyclohexen-1-yl)-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 70308009 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(5-ethylcyclohexen-1-yl)-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | CCC1CCC=C(C2=CN=Cc3ccccc3S2(=O)=O)C1 |
| InChI | InChI=1S/C17H19NO2S/c1-2-13-6-5-8-14(10-13)17-12-18-11-15-7-3-4-9-16(15)21(17,19)20/h3-4,7-9,11-13H,2,5-6,10H2,1H3 |
| InChIKey | KRFICOABRUUBKX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |