C20H26 — CID 139809709
(1Z,11Z)-2,14-diethyltricyclo[10.4.0.04,9]hexadeca-1,4,6,8,11-pentaene (PubChem CID 139809709) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (1Z,11Z)-2,14-diethyltricyclo[10.4.0.04,9]hexadeca-1,4,6,8,11-pentaene.
| Compound Name | (1Z,11Z)-2,14-diethyltricyclo[10.4.0.04,9]hexadeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 139809709 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (1Z,11Z)-2,14-diethyltricyclo[10.4.0.04,9]hexadeca-1,4,6,8,11-pentaene |
| SMILES | CC/C1=C2\CCC(CC)C\C2=C\Cc2ccccc2C1 |
| InChI | InChI=1S/C20H26/c1-3-15-9-12-20-16(4-2)14-18-8-6-5-7-17(18)10-11-19(20)13-15/h5-8,11,15H,3-4,9-10,12-14H2,1-2H3/b19-11-,20-16- |
| InChIKey | HCOKTMVQOYNHBD-OJRHGFLZSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |