C9H10INO6 — CID 70311963
(1S,6R,9S)-4-hydroxy-9-iodo-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid (PubChem CID 70311963) has the molecular formula C9H10INO6 and a molecular weight of 355.08 g/mol. Its IUPAC name is (1S,6R,9S)-4-hydroxy-9-iodo-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid.
| Compound Name | (1S,6R,9S)-4-hydroxy-9-iodo-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 70311963 |
| Molecular Formula | C9H10INO6 |
| Molecular Weight | 355.08 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | (1S,6R,9S)-4-hydroxy-9-iodo-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylic acid |
| SMILES | O=C1[C@@H]2CC(O)OC2[C@]2(C(=O)O)CO[C@@H](I)N12 |
| InChI | InChI=1S/C9H10INO6/c10-8-11-6(13)3-1-4(12)17-5(3)9(11,2-16-8)7(14)15/h3-5,8,12H,1-2H2,(H,14,15)/t3-,4?,5?,8+,9+/m1/s1 |
| InChIKey | ZYMOVHBIVVKREA-DGDSQABPSA-N |
| XLogP | -0.88 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.08 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|