C25H31N3O4 — CID 70313441
4-[(3S,5R)-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]benzonitrile (PubChem CID 70313441) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[(3S,5R)-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]benzonitrile.
| Compound Name | 4-[(3S,5R)-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 70313441 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 4-[(3S,5R)-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]benzonitrile |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CNC[C@@H](O)C3c3ccc(C#N)cc3)cc21 |
| InChI | InChI=1S/C25H31N3O4/c1-30-11-2-9-28-10-12-31-23-8-5-19(13-21(23)28)17-32-24-16-27-15-22(29)25(24)20-6-3-18(14-26)4-7-20/h3-8,13,22,24-25,27,29H,2,9-12,15-17H2,1H3/t22-,24+,25?/m1/s1 |
| InChIKey | UIIBAIVVHNOWOG-JNLGJKASSA-N |
| XLogP | 2.43 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|