C16H19ClO3 — CID 70316138
prop-2-enyl 2-[2-(chloromethyl)-5-prop-2-enylphenoxy]propanoate (PubChem CID 70316138) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(chloromethyl)-5-prop-2-enylphenoxy]propanoate.
| Compound Name | prop-2-enyl 2-[2-(chloromethyl)-5-prop-2-enylphenoxy]propanoate |
|---|---|
| PubChem CID | 70316138 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | prop-2-enyl 2-[2-(chloromethyl)-5-prop-2-enylphenoxy]propanoate |
| SMILES | C=CCOC(=O)C(C)Oc1cc(CC=C)ccc1CCl |
| InChI | InChI=1S/C16H19ClO3/c1-4-6-13-7-8-14(11-17)15(10-13)20-12(3)16(18)19-9-5-2/h4-5,7-8,10,12H,1-2,6,9,11H2,3H3 |
| InChIKey | UFJKHUZLGSZAJK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|