C23H27N7O3 — CID 70316585
7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(5-methylpyrazin-2-yl)methylamino]-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70316585) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(5-methylpyrazin-2-yl)methylamino]-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(5-methylpyrazin-2-yl)methylamino]-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70316585 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[(5-methylpyrazin-2-yl)methylamino]-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCc2cnc(C)cn2)nc2ncc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C23H27N7O3/c1-5-7-32-8-6-30-19-9-17(20-15(3)29-33-16(20)4)11-26-21(19)28-22(23(30)31)27-13-18-12-24-14(2)10-25-18/h9-12H,5-8,13H2,1-4H3,(H,26,27,28) |
| InChIKey | AFCOSTPDHDKUFB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|