C43H52N2O5 — CID 70316954
N-[(6S)-1-cyclohexyl-6-hydroxy-7-[3-(4-methylphenoxy)propanoylamino]-8-phenyloctan-4-yl]-3-phenoxybenzamide (PubChem CID 70316954) has the molecular formula C43H52N2O5 and a molecular weight of 676.90 g/mol. Its IUPAC name is N-[(6S)-1-cyclohexyl-6-hydroxy-7-[3-(4-methylphenoxy)propanoylamino]-8-phenyloctan-4-yl]-3-phenoxybenzamide.
| Compound Name | N-[(6S)-1-cyclohexyl-6-hydroxy-7-[3-(4-methylphenoxy)propanoylamino]-8-phenyloctan-4-yl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 70316954 |
| Molecular Formula | C43H52N2O5 |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.39 |
| IUPAC Name | N-[(6S)-1-cyclohexyl-6-hydroxy-7-[3-(4-methylphenoxy)propanoylamino]-8-phenyloctan-4-yl]-3-phenoxybenzamide |
| SMILES | Cc1ccc(OCCC(=O)NC(Cc2ccccc2)[C@@H](O)CC(CCCC2CCCCC2)NC(=O)c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C43H52N2O5/c1-32-23-25-37(26-24-32)49-28-27-42(47)45-40(29-34-15-7-3-8-16-34)41(46)31-36(19-11-17-33-13-5-2-6-14-33)44-43(48)35-18-12-22-39(30-35)50-38-20-9-4-10-21-38/h3-4,7-10,12,15-16,18,20-26,30,33,36,40-41,46H,2,5-6,11,13-14,17,19,27-29,31H2,1H3,(H,44,48)(H,45,47)/t36?,40?,41-/m0/s1 |
| InChIKey | UUOCXMXJPMSPIZ-AWJNOIJUSA-N |
| XLogP | 8.58 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |