C40H46N2O5 — CID 70318050
N-[(3S)-1-cyclohexyl-3-hydroxy-4-[3-(4-methylphenoxy)propanoylamino]-5-phenylpentyl]-3-phenoxybenzamide (PubChem CID 70318050) has the molecular formula C40H46N2O5 and a molecular weight of 634.82 g/mol. Its IUPAC name is N-[(3S)-1-cyclohexyl-3-hydroxy-4-[3-(4-methylphenoxy)propanoylamino]-5-phenylpentyl]-3-phenoxybenzamide.
| Compound Name | N-[(3S)-1-cyclohexyl-3-hydroxy-4-[3-(4-methylphenoxy)propanoylamino]-5-phenylpentyl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 70318050 |
| Molecular Formula | C40H46N2O5 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | N-[(3S)-1-cyclohexyl-3-hydroxy-4-[3-(4-methylphenoxy)propanoylamino]-5-phenylpentyl]-3-phenoxybenzamide |
| SMILES | Cc1ccc(OCCC(=O)NC(Cc2ccccc2)[C@@H](O)CC(NC(=O)c2cccc(Oc3ccccc3)c2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C40H46N2O5/c1-29-20-22-33(23-21-29)46-25-24-39(44)41-37(26-30-12-5-2-6-13-30)38(43)28-36(31-14-7-3-8-15-31)42-40(45)32-16-11-19-35(27-32)47-34-17-9-4-10-18-34/h2,4-6,9-13,16-23,27,31,36-38,43H,3,7-8,14-15,24-26,28H2,1H3,(H,41,44)(H,42,45)/t36?,37?,38-/m0/s1 |
| InChIKey | ZCSLELNYMBHQGG-KLQRRAJASA-N |
| XLogP | 7.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |