C25H34N6O3 — CID 70320747
7-(6-methoxy-3-pyridinyl)-1-(4-methylpentyl)-3-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70320747) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 7-(6-methoxy-3-pyridinyl)-1-(4-methylpentyl)-3-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-(6-methoxy-3-pyridinyl)-1-(4-methylpentyl)-3-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70320747 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 7-(6-methoxy-3-pyridinyl)-1-(4-methylpentyl)-3-(2-morpholin-4-ylethylamino)pyrido[2,3-b]pyrazin-2-one |
| SMILES | COc1ccc(-c2cnc3nc(NCCN4CCOCC4)c(=O)n(CCCC(C)C)c3c2)cn1 |
| InChI | InChI=1S/C25H34N6O3/c1-18(2)5-4-9-31-21-15-20(19-6-7-22(33-3)27-16-19)17-28-23(21)29-24(25(31)32)26-8-10-30-11-13-34-14-12-30/h6-7,15-18H,4-5,8-14H2,1-3H3,(H,26,28,29) |
| InChIKey | KGHWYNVYFIUDRV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|