C18H24F3NO — CID 70323641
1-[2-(4-methyl-3-propylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]ethanone (PubChem CID 70323641) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-[2-(4-methyl-3-propylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[2-(4-methyl-3-propylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 70323641 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[2-(4-methyl-3-propylpiperidin-1-yl)-4-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCCC1CN(c2cc(C(F)(F)F)ccc2C(C)=O)CCC1C |
| InChI | InChI=1S/C18H24F3NO/c1-4-5-14-11-22(9-8-12(14)2)17-10-15(18(19,20)21)6-7-16(17)13(3)23/h6-7,10,12,14H,4-5,8-9,11H2,1-3H3 |
| InChIKey | YFZYOEPUVIRUFD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |