C14H13F6NO2S — CID 90097923
[1-[2,4-bis(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl acetate (PubChem CID 90097923) has the molecular formula C14H13F6NO2S and a molecular weight of 373.32 g/mol. Its IUPAC name is [1-[2,4-bis(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl acetate.
| Compound Name | [1-[2,4-bis(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl acetate |
|---|---|
| PubChem CID | 90097923 |
| Molecular Formula | C14H13F6NO2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [1-[2,4-bis(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl acetate |
| SMILES | CC(=O)OSC1CCN(c2ccc(C(F)(F)F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C14H13F6NO2S/c1-8(22)23-24-10-4-5-21(7-10)12-3-2-9(13(15,16)17)6-11(12)14(18,19)20/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | IMKIGLOHXDNRTG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|