C20H27F3O6 — CID 70328056
dipropan-2-yl (2S)-2-hydroxy-3-[3-[4-(trifluoromethoxy)phenyl]propyl]butanedioate (PubChem CID 70328056) has the molecular formula C20H27F3O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is dipropan-2-yl (2S)-2-hydroxy-3-[3-[4-(trifluoromethoxy)phenyl]propyl]butanedioate.
| Compound Name | dipropan-2-yl (2S)-2-hydroxy-3-[3-[4-(trifluoromethoxy)phenyl]propyl]butanedioate |
|---|---|
| PubChem CID | 70328056 |
| Molecular Formula | C20H27F3O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | dipropan-2-yl (2S)-2-hydroxy-3-[3-[4-(trifluoromethoxy)phenyl]propyl]butanedioate |
| SMILES | CC(C)OC(=O)C(CCCc1ccc(OC(F)(F)F)cc1)[C@H](O)C(=O)OC(C)C |
| InChI | InChI=1S/C20H27F3O6/c1-12(2)27-18(25)16(17(24)19(26)28-13(3)4)7-5-6-14-8-10-15(11-9-14)29-20(21,22)23/h8-13,16-17,24H,5-7H2,1-4H3/t16?,17-/m0/s1 |
| InChIKey | ANXZHCDGSBMJKP-DJNXLDHESA-N |
| XLogP | 3.79 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |