C27H30ClNO3 — CID 70329366
tert-butyl 2-[2-[2-(2-chlorophenyl)-4-phenylphenoxy]ethyl-methylamino]acetate (PubChem CID 70329366) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(2-chlorophenyl)-4-phenylphenoxy]ethyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[2-[2-(2-chlorophenyl)-4-phenylphenoxy]ethyl-methylamino]acetate |
|---|---|
| PubChem CID | 70329366 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | tert-butyl 2-[2-[2-(2-chlorophenyl)-4-phenylphenoxy]ethyl-methylamino]acetate |
| SMILES | CN(CCOc1ccc(-c2ccccc2)cc1-c1ccccc1Cl)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H30ClNO3/c1-27(2,3)32-26(30)19-29(4)16-17-31-25-15-14-21(20-10-6-5-7-11-20)18-23(25)22-12-8-9-13-24(22)28/h5-15,18H,16-17,19H2,1-4H3 |
| InChIKey | HVVZAAXCJRPQCR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |