About 6-fluoro-7,8a-dimethyl-4aH-isoquinoline
6-fluoro-7,8a-dimethyl-4aH-isoquinoline (PubChem CID 70334339) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 6-fluoro-7,8a-dimethyl-4aH-isoquinoline.
Molecular Properties
| Compound Name | 6-fluoro-7,8a-dimethyl-4aH-isoquinoline |
| PubChem CID | 70334339 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-fluoro-7,8a-dimethyl-4aH-isoquinoline |
| SMILES | CC1=CC2(C)C=NC=CC2C=C1F |
| InChI | InChI=1S/C11H12FN/c1-8-6-11(2)7-13-4-3-9(11)5-10(8)12/h3-7,9H,1-2H3 |
| InChIKey | HWRWTSPCWKOQNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-7,8a-dimethyl-4aH-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7,8a-dimethyl-4aH-isoquinoline?
The IUPAC name of 6-fluoro-7,8a-dimethyl-4aH-isoquinoline (CID 70334339) is 6-fluoro-7,8a-dimethyl-4aH-isoquinoline.
What is the SMILES notation for 6-fluoro-7,8a-dimethyl-4aH-isoquinoline?
The canonical SMILES for 6-fluoro-7,8a-dimethyl-4aH-isoquinoline is CC1=CC2(C)C=NC=CC2C=C1F.
What is the InChIKey of 6-fluoro-7,8a-dimethyl-4aH-isoquinoline?
The InChIKey is HWRWTSPCWKOQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN/c1-8-6-11(2)7-13-4-3-9(11)5-10(8)12/h3-7,9H,1-2H3.
What are the key properties of 6-fluoro-7,8a-dimethyl-4aH-isoquinoline?
6-fluoro-7,8a-dimethyl-4aH-isoquinoline has a molecular weight of 177.22 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7,8a-dimethyl-4aH-isoquinoline is sourced from PubChem (CID 70334339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).