C19H29NO6S — CID 70340721
4-hydroxy-2-methyl-2-[pentylsulfonyl(3-phenylpropanoyl)amino]butanoic acid (PubChem CID 70340721) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-2-[pentylsulfonyl(3-phenylpropanoyl)amino]butanoic acid.
| Compound Name | 4-hydroxy-2-methyl-2-[pentylsulfonyl(3-phenylpropanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 70340721 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-hydroxy-2-methyl-2-[pentylsulfonyl(3-phenylpropanoyl)amino]butanoic acid |
| SMILES | CCCCCS(=O)(=O)N(C(=O)CCc1ccccc1)C(C)(CCO)C(=O)O |
| InChI | InChI=1S/C19H29NO6S/c1-3-4-8-15-27(25,26)20(19(2,13-14-21)18(23)24)17(22)12-11-16-9-6-5-7-10-16/h5-7,9-10,21H,3-4,8,11-15H2,1-2H3,(H,23,24) |
| InChIKey | YCULTFWTGUEZBH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|