C19H22N2O2 — CID 70344591
tert-butyl 3-cyanospiro[indene-1,4'-piperidine]-1'-carboxylate (PubChem CID 70344591) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl 3-cyanospiro[indene-1,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 3-cyanospiro[indene-1,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 70344591 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl 3-cyanospiro[indene-1,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C=C(C#N)c3ccccc32)CC1 |
| InChI | InChI=1S/C19H22N2O2/c1-18(2,3)23-17(22)21-10-8-19(9-11-21)12-14(13-20)15-6-4-5-7-16(15)19/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | MSSWPXVZPAHDSH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |