C9H10ClIN2O2 — CID 70346476
1-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-iodoethyl]urea (PubChem CID 70346476) has the molecular formula C9H10ClIN2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-iodoethyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-iodoethyl]urea |
|---|---|
| PubChem CID | 70346476 |
| Molecular Formula | C9H10ClIN2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1S)-2-hydroxy-1-iodoethyl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N[C@@H](I)CO |
| InChI | InChI=1S/C9H10ClIN2O2/c10-6-1-3-7(4-2-6)12-9(15)13-8(11)5-14/h1-4,8,14H,5H2,(H2,12,13,15)/t8-/m1/s1 |
| InChIKey | UUBJROKIWMXZGI-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|