C20H24O4 — CID 70350508
2-[[3-(1-hydroxypentyl)phenoxy]methyl]-3-methylbenzoic acid (PubChem CID 70350508) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[[3-(1-hydroxypentyl)phenoxy]methyl]-3-methylbenzoic acid.
| Compound Name | 2-[[3-(1-hydroxypentyl)phenoxy]methyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 70350508 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[[3-(1-hydroxypentyl)phenoxy]methyl]-3-methylbenzoic acid |
| SMILES | CCCCC(O)c1cccc(OCc2c(C)cccc2C(=O)O)c1 |
| InChI | InChI=1S/C20H24O4/c1-3-4-11-19(21)15-8-6-9-16(12-15)24-13-18-14(2)7-5-10-17(18)20(22)23/h5-10,12,19,21H,3-4,11,13H2,1-2H3,(H,22,23) |
| InChIKey | LPFHKFMJIWVPLX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |