C32H50O5 — CID 70351366
prop-2-enyl (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7,12-dioxo-3-pentoxy-2,3,4,5,6,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 70351366) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is prop-2-enyl (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7,12-dioxo-3-pentoxy-2,3,4,5,6,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | prop-2-enyl (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7,12-dioxo-3-pentoxy-2,3,4,5,6,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 70351366 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | prop-2-enyl (4R)-4-[(3R,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-7,12-dioxo-3-pentoxy-2,3,4,5,6,8,9,11,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C=CCOC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)CC4C[C@H](OCCCCC)CC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C32H50O5/c1-6-8-9-17-36-23-14-15-31(4)22(18-23)19-27(33)30-25-12-11-24(32(25,5)28(34)20-26(30)31)21(3)10-13-29(35)37-16-7-2/h7,21-26,30H,2,6,8-20H2,1,3-5H3/t21-,22?,23-,24-,25+,26+,30+,31+,32-/m1/s1 |
| InChIKey | RGISHUFCOYRIIT-IITKEUHRSA-N |
| XLogP | 6.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|