C10H7N3 — CID 70352768
pyrrolo[1,2-c][1,2,3]benzotriazine (PubChem CID 70352768) has the molecular formula C10H7N3 and a molecular weight of 169.19 g/mol. Its IUPAC name is pyrrolo[1,2-c][1,2,3]benzotriazine.
| Compound Name | pyrrolo[1,2-c][1,2,3]benzotriazine |
|---|---|
| PubChem CID | 70352768 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | pyrrolo[1,2-c][1,2,3]benzotriazine |
| SMILES | c1ccc2c(c1)nnn1cccc21 |
| InChI | InChI=1S/C10H7N3/c1-2-5-9-8(4-1)10-6-3-7-13(10)12-11-9/h1-7H |
| InChIKey | CAMMJEXRQPBEMY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |