C26H16N2O6 — CID 70353159
(9-carboxyoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl) hydrogen carbonate (PubChem CID 70353159) has the molecular formula C26H16N2O6 and a molecular weight of 452.42 g/mol. Its IUPAC name is (9-carboxyoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl) hydrogen carbonate.
| Compound Name | (9-carboxyoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70353159 |
| Molecular Formula | C26H16N2O6 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (9-carboxyoxy-4,7-diphenyl-1,10-phenanthrolin-2-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(OC(=O)O)nc3c2n1 |
| InChI | InChI=1S/C26H16N2O6/c29-25(30)33-21-13-19(15-7-3-1-4-8-15)17-11-12-18-20(16-9-5-2-6-10-16)14-22(34-26(31)32)28-24(18)23(17)27-21/h1-14H,(H,29,30)(H,31,32) |
| InChIKey | QKQVYRSSOKFSES-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|