C26H27N5O7 — CID 70354028
but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-4-methyl-6-(4-nitrophenyl)-2-phenylpyrimidine-5-carboxamide (PubChem CID 70354028) has the molecular formula C26H27N5O7 and a molecular weight of 521.53 g/mol. Its IUPAC name is but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-4-methyl-6-(4-nitrophenyl)-2-phenylpyrimidine-5-carboxamide.
| Compound Name | but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-4-methyl-6-(4-nitrophenyl)-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70354028 |
| Molecular Formula | C26H27N5O7 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | but-2-enedioic acid;N-[2-(dimethylamino)ethyl]-4-methyl-6-(4-nitrophenyl)-2-phenylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccc([N+](=O)[O-])cc2)c1C(=O)NCCN(C)C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H23N5O3.C4H4O4/c1-15-19(22(28)23-13-14-26(2)3)20(16-9-11-18(12-10-16)27(29)30)25-21(24-15)17-7-5-4-6-8-17;5-3(6)1-2-4(7)8/h4-12H,13-14H2,1-3H3,(H,23,28);1-2H,(H,5,6)(H,7,8) |
| InChIKey | CINHREJSYYQCLC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 175.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|