About bis(but-2-enoic acid);nitrobenzene
bis(but-2-enoic acid);nitrobenzene (PubChem CID 67587099) has the molecular formula C14H17NO6
and a molecular weight of 295.29 g/mol. Its IUPAC name is bis(but-2-enoic acid);nitrobenzene.
Molecular Properties
| Compound Name | bis(but-2-enoic acid);nitrobenzene |
| PubChem CID | 67587099 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | bis(but-2-enoic acid);nitrobenzene |
| SMILES | CC=CC(=O)O.CC=CC(=O)O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.2C4H6O2/c8-7(9)6-4-2-1-3-5-6;2*1-2-3-4(5)6/h1-5H;2*2-3H,1H3,(H,5,6) |
| InChIKey | JDCNZRQDVLPKRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(but-2-enoic acid);nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(but-2-enoic acid);nitrobenzene?
The IUPAC name of bis(but-2-enoic acid);nitrobenzene (CID 67587099) is bis(but-2-enoic acid);nitrobenzene.
What is the SMILES notation for bis(but-2-enoic acid);nitrobenzene?
The canonical SMILES for bis(but-2-enoic acid);nitrobenzene is CC=CC(=O)O.CC=CC(=O)O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of bis(but-2-enoic acid);nitrobenzene?
The InChIKey is JDCNZRQDVLPKRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.2C4H6O2/c8-7(9)6-4-2-1-3-5-6;2*1-2-3-4(5)6/h1-5H;2*2-3H,1H3,(H,5,6).
What are the key properties of bis(but-2-enoic acid);nitrobenzene?
bis(but-2-enoic acid);nitrobenzene has a molecular weight of 295.29 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(but-2-enoic acid);nitrobenzene is sourced from PubChem (CID 67587099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).