C26H29N5O6 — CID 70354446
but-2-enedioic acid;N',N'-dimethyl-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]ethane-1,2-diamine (PubChem CID 70354446) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is but-2-enedioic acid;N',N'-dimethyl-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]ethane-1,2-diamine.
| Compound Name | but-2-enedioic acid;N',N'-dimethyl-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70354446 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | but-2-enedioic acid;N',N'-dimethyl-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]ethane-1,2-diamine |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2cccc([N+](=O)[O-])c2)c1CNCCN(C)C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H25N5O2.C4H4O4/c1-16-20(15-23-12-13-26(2)3)21(18-10-7-11-19(14-18)27(28)29)25-22(24-16)17-8-5-4-6-9-17;5-3(6)1-2-4(7)8/h4-11,14,23H,12-13,15H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UDJWWMAOKIPOHL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|