C24H27N5O4 — CID 10321485
methyl 4-[2-[2-(dimethylamino)ethylamino]ethyl]-6-(3-nitrophenyl)-2-phenylpyrimidine-5-carboxylate (PubChem CID 10321485) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is methyl 4-[2-[2-(dimethylamino)ethylamino]ethyl]-6-(3-nitrophenyl)-2-phenylpyrimidine-5-carboxylate.
| Compound Name | methyl 4-[2-[2-(dimethylamino)ethylamino]ethyl]-6-(3-nitrophenyl)-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10321485 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | methyl 4-[2-[2-(dimethylamino)ethylamino]ethyl]-6-(3-nitrophenyl)-2-phenylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(CCNCCN(C)C)nc(-c2ccccc2)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27N5O4/c1-28(2)15-14-25-13-12-20-21(24(30)33-3)22(18-10-7-11-19(16-18)29(31)32)27-23(26-20)17-8-5-4-6-9-17/h4-11,16,25H,12-15H2,1-3H3 |
| InChIKey | PGKIECNXNTVJCJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|