C23H27N5O2 — CID 70419724
1-N,2-dimethyl-1-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]propane-1,2-diamine (PubChem CID 70419724) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-N,2-dimethyl-1-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]propane-1,2-diamine.
| Compound Name | 1-N,2-dimethyl-1-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 70419724 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-N,2-dimethyl-1-N-[[4-methyl-6-(3-nitrophenyl)-2-phenylpyrimidin-5-yl]methyl]propane-1,2-diamine |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2cccc([N+](=O)[O-])c2)c1CN(C)CC(C)(C)N |
| InChI | InChI=1S/C23H27N5O2/c1-16-20(14-27(4)15-23(2,3)24)21(18-11-8-12-19(13-18)28(29)30)26-22(25-16)17-9-6-5-7-10-17/h5-13H,14-15,24H2,1-4H3 |
| InChIKey | KFXMISJTNWKNCP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|