C29H36N2O2 — CID 70357969
N-benzyl-4-oxo-2,6-dipentyl-N-phenyl-1H-pyridine-3-carboxamide (PubChem CID 70357969) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is N-benzyl-4-oxo-2,6-dipentyl-N-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | N-benzyl-4-oxo-2,6-dipentyl-N-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 70357969 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | N-benzyl-4-oxo-2,6-dipentyl-N-phenyl-1H-pyridine-3-carboxamide |
| SMILES | CCCCCc1cc(=O)c(C(=O)N(Cc2ccccc2)c2ccccc2)c(CCCCC)[nH]1 |
| InChI | InChI=1S/C29H36N2O2/c1-3-5-9-17-24-21-27(32)28(26(30-24)20-10-6-4-2)29(33)31(25-18-13-8-14-19-25)22-23-15-11-7-12-16-23/h7-8,11-16,18-19,21H,3-6,9-10,17,20,22H2,1-2H3,(H,30,32) |
| InChIKey | WAGJUUASKSGFMI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|