C16H24N2O7S — CID 70362996
8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;sulfuric acid (PubChem CID 70362996) has the molecular formula C16H24N2O7S and a molecular weight of 388.44 g/mol. Its IUPAC name is 8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;sulfuric acid.
| Compound Name | 8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;sulfuric acid |
|---|---|
| PubChem CID | 70362996 |
| Molecular Formula | C16H24N2O7S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 8-hydroxy-5-[1-hydroxy-2-(propan-2-ylamino)butyl]-1H-quinolin-2-one;sulfuric acid |
| SMILES | CCC(NC(C)C)C(O)c1ccc(O)c2[nH]c(=O)ccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C16H22N2O3.H2O4S/c1-4-12(17-9(2)3)16(21)11-5-7-13(19)15-10(11)6-8-14(20)18-15;1-5(2,3)4/h5-9,12,16-17,19,21H,4H2,1-3H3,(H,18,20);(H2,1,2,3,4) |
| InChIKey | IZHKASZZQOKKFV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|