C26H38N2O4 — CID 23342067
[5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinolin-8-yl] 3-cyclohexyl-2-methylpropanoate (PubChem CID 23342067) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is [5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinolin-8-yl] 3-cyclohexyl-2-methylpropanoate.
| Compound Name | [5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinolin-8-yl] 3-cyclohexyl-2-methylpropanoate |
|---|---|
| PubChem CID | 23342067 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | [5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinolin-8-yl] 3-cyclohexyl-2-methylpropanoate |
| SMILES | CCC(NC(C)C)C(O)c1ccc(OC(=O)C(C)CC2CCCCC2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C26H38N2O4/c1-5-21(27-16(2)3)25(30)20-11-13-22(24-19(20)12-14-23(29)28-24)32-26(31)17(4)15-18-9-7-6-8-10-18/h11-14,16-18,21,25,27,30H,5-10,15H2,1-4H3,(H,28,29) |
| InChIKey | IERQYSDJDIESES-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|