C35H44N2O5 — CID 23342063
[2-(benzylamino)-1-[8-(2-cyclohexylacetyl)oxy-2-oxo-1H-quinolin-5-yl]butyl] cyclohexanecarboxylate (PubChem CID 23342063) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is [2-(benzylamino)-1-[8-(2-cyclohexylacetyl)oxy-2-oxo-1H-quinolin-5-yl]butyl] cyclohexanecarboxylate.
| Compound Name | [2-(benzylamino)-1-[8-(2-cyclohexylacetyl)oxy-2-oxo-1H-quinolin-5-yl]butyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 23342063 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | [2-(benzylamino)-1-[8-(2-cyclohexylacetyl)oxy-2-oxo-1H-quinolin-5-yl]butyl] cyclohexanecarboxylate |
| SMILES | CCC(NCc1ccccc1)C(OC(=O)C1CCCCC1)c1ccc(OC(=O)CC2CCCCC2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C35H44N2O5/c1-2-29(36-23-25-14-8-4-9-15-25)34(42-35(40)26-16-10-5-11-17-26)28-18-20-30(33-27(28)19-21-31(38)37-33)41-32(39)22-24-12-6-3-7-13-24/h4,8-9,14-15,18-21,24,26,29,34,36H,2-3,5-7,10-13,16-17,22-23H2,1H3,(H,37,38) |
| InChIKey | PRHWHNJRMHJJMG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|