C27H25ClN2O4 — CID 23342058
[5-[2-(benzylamino)-1-hydroxybutyl]-2-oxo-1H-quinolin-8-yl] 4-chlorobenzoate (PubChem CID 23342058) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is [5-[2-(benzylamino)-1-hydroxybutyl]-2-oxo-1H-quinolin-8-yl] 4-chlorobenzoate.
| Compound Name | [5-[2-(benzylamino)-1-hydroxybutyl]-2-oxo-1H-quinolin-8-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 23342058 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [5-[2-(benzylamino)-1-hydroxybutyl]-2-oxo-1H-quinolin-8-yl] 4-chlorobenzoate |
| SMILES | CCC(NCc1ccccc1)C(O)c1ccc(OC(=O)c2ccc(Cl)cc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C27H25ClN2O4/c1-2-22(29-16-17-6-4-3-5-7-17)26(32)21-12-14-23(25-20(21)13-15-24(31)30-25)34-27(33)18-8-10-19(28)11-9-18/h3-15,22,26,29,32H,2,16H2,1H3,(H,30,31) |
| InChIKey | RFBAZSUSYKDODV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|