C17H22N2O4 — CID 141419025
5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinoline-8-carboxylic acid (PubChem CID 141419025) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinoline-8-carboxylic acid.
| Compound Name | 5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 141419025 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 5-[1-hydroxy-2-(propan-2-ylamino)butyl]-2-oxo-1H-quinoline-8-carboxylic acid |
| SMILES | CCC(NC(C)C)C(O)c1ccc(C(=O)O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C17H22N2O4/c1-4-13(18-9(2)3)16(21)11-5-6-12(17(22)23)15-10(11)7-8-14(20)19-15/h5-9,13,16,18,21H,4H2,1-3H3,(H,19,20)(H,22,23) |
| InChIKey | GCTZLUVYJSJALL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |