C30H38N2O4 — CID 54004191
[5-[1-hydroxy-2-[(2-methyl-1-phenylpropan-2-yl)amino]butyl]-2-oxo-1H-quinolin-8-yl] cyclohexanecarboxylate (PubChem CID 54004191) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is [5-[1-hydroxy-2-[(2-methyl-1-phenylpropan-2-yl)amino]butyl]-2-oxo-1H-quinolin-8-yl] cyclohexanecarboxylate.
| Compound Name | [5-[1-hydroxy-2-[(2-methyl-1-phenylpropan-2-yl)amino]butyl]-2-oxo-1H-quinolin-8-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 54004191 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | [5-[1-hydroxy-2-[(2-methyl-1-phenylpropan-2-yl)amino]butyl]-2-oxo-1H-quinolin-8-yl] cyclohexanecarboxylate |
| SMILES | CCC(NC(C)(C)Cc1ccccc1)C(O)c1ccc(OC(=O)C2CCCCC2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C30H38N2O4/c1-4-24(32-30(2,3)19-20-11-7-5-8-12-20)28(34)23-15-17-25(27-22(23)16-18-26(33)31-27)36-29(35)21-13-9-6-10-14-21/h5,7-8,11-12,15-18,21,24,28,32,34H,4,6,9-10,13-14,19H2,1-3H3,(H,31,33) |
| InChIKey | KNRKYJSFHMYMSK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|