C27H30N2O5 — CID 23342070
[5-[1-(cyclobutanecarbonyloxy)-2-(propan-2-ylamino)ethyl]-2-oxo-1H-quinolin-8-yl] 4-methylbenzoate (PubChem CID 23342070) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is [5-[1-(cyclobutanecarbonyloxy)-2-(propan-2-ylamino)ethyl]-2-oxo-1H-quinolin-8-yl] 4-methylbenzoate.
| Compound Name | [5-[1-(cyclobutanecarbonyloxy)-2-(propan-2-ylamino)ethyl]-2-oxo-1H-quinolin-8-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 23342070 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [5-[1-(cyclobutanecarbonyloxy)-2-(propan-2-ylamino)ethyl]-2-oxo-1H-quinolin-8-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(CNC(C)C)OC(=O)C3CCC3)c3ccc(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C27H30N2O5/c1-16(2)28-15-23(34-26(31)18-5-4-6-18)20-11-13-22(25-21(20)12-14-24(30)29-25)33-27(32)19-9-7-17(3)8-10-19/h7-14,16,18,23,28H,4-6,15H2,1-3H3,(H,29,30) |
| InChIKey | KKJYFPOIADHTGX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|