C14H17NO7 — CID 70363535
3-acetamido-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;acetic acid (PubChem CID 70363535) has the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-acetamido-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;acetic acid.
| Compound Name | 3-acetamido-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;acetic acid |
|---|---|
| PubChem CID | 70363535 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-acetamido-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid;acetic acid |
| SMILES | CC(=O)O.COc1cc(C(=CC(=O)O)NC(C)=O)ccc1O |
| InChI | InChI=1S/C12H13NO5.C2H4O2/c1-7(14)13-9(6-12(16)17)8-3-4-10(15)11(5-8)18-2;1-2(3)4/h3-6,15H,1-2H3,(H,13,14)(H,16,17);1H3,(H,3,4) |
| InChIKey | GDGBPQWINBCPAV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|