C36H40F2O7Si2 — CID 70364236
(4-fluorophenyl) 4-[3-[[3-[4-(4-fluorophenoxy)carbonylphenoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]benzoate (PubChem CID 70364236) has the molecular formula C36H40F2O7Si2 and a molecular weight of 678.88 g/mol. Its IUPAC name is (4-fluorophenyl) 4-[3-[[3-[4-(4-fluorophenoxy)carbonylphenoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]benzoate.
| Compound Name | (4-fluorophenyl) 4-[3-[[3-[4-(4-fluorophenoxy)carbonylphenoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]benzoate |
|---|---|
| PubChem CID | 70364236 |
| Molecular Formula | C36H40F2O7Si2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | (4-fluorophenyl) 4-[3-[[3-[4-(4-fluorophenoxy)carbonylphenoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]propoxy]benzoate |
| SMILES | C[Si](C)(CCCOc1ccc(C(=O)Oc2ccc(F)cc2)cc1)O[Si](C)(C)CCCOc1ccc(C(=O)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C36H40F2O7Si2/c1-46(2,25-5-23-41-31-15-7-27(8-16-31)35(39)43-33-19-11-29(37)12-20-33)45-47(3,4)26-6-24-42-32-17-9-28(10-18-32)36(40)44-34-21-13-30(38)14-22-34/h7-22H,5-6,23-26H2,1-4H3 |
| InChIKey | RYEBZGOFMKKVMD-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|