C18H23NO2 — CID 70364751
(1S,4aS)-1-acetyl-2-methyl-7-phenyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one (PubChem CID 70364751) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1S,4aS)-1-acetyl-2-methyl-7-phenyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one.
| Compound Name | (1S,4aS)-1-acetyl-2-methyl-7-phenyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 70364751 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1S,4aS)-1-acetyl-2-methyl-7-phenyl-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-one |
| SMILES | CC(=O)[C@@H]1C2CC(c3ccccc3)C(=O)C[C@@H]2CCN1C |
| InChI | InChI=1S/C18H23NO2/c1-12(20)18-16-11-15(13-6-4-3-5-7-13)17(21)10-14(16)8-9-19(18)2/h3-7,14-16,18H,8-11H2,1-2H3/t14-,15?,16?,18+/m0/s1 |
| InChIKey | CFYJYPUFGKDETP-MMIPBJDJSA-N |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |