C22H27O6Si — CID 70366662
CID 70366662 (PubChem CID 70366662) has the molecular formula C22H27O6Si and a molecular weight of 415.54 g/mol.
| Compound Name | CID 70366662 |
|---|---|
| PubChem CID | 70366662 |
| Molecular Formula | C22H27O6Si |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | — |
| SMILES | CCOC(C[Si])C(OCC)(OCC)Oc1ccc(C(=O)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C22H27O6Si/c1-4-25-20(15-29)22(26-5-2,27-6-3)28-17-12-13-18(19(23)14-17)21(24)16-10-8-7-9-11-16/h7-14,20,23H,4-6,15H2,1-3H3 |
| InChIKey | LHRNUHHXZZGMJA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|