C22H14Cl3N3O — CID 70366700
1-(4-chloro-3-quinolin-4-ylphenyl)-3-(2,4-dichlorophenyl)urea (PubChem CID 70366700) has the molecular formula C22H14Cl3N3O and a molecular weight of 442.73 g/mol. Its IUPAC name is 1-(4-chloro-3-quinolin-4-ylphenyl)-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-(4-chloro-3-quinolin-4-ylphenyl)-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 70366700 |
| Molecular Formula | C22H14Cl3N3O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 1-(4-chloro-3-quinolin-4-ylphenyl)-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccnc3ccccc23)c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H14Cl3N3O/c23-13-5-8-21(19(25)11-13)28-22(29)27-14-6-7-18(24)17(12-14)15-9-10-26-20-4-2-1-3-16(15)20/h1-12H,(H2,27,28,29) |
| InChIKey | KWTSPNLBIUCGFY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |