C13H8Cl2N4OS — CID 3784740
1-(1,2,3-benzothiadiazol-5-yl)-3-(2,4-dichlorophenyl)urea (PubChem CID 3784740) has the molecular formula C13H8Cl2N4OS and a molecular weight of 339.21 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-5-yl)-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 3784740 |
| Molecular Formula | C13H8Cl2N4OS |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc2snnc2c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl2N4OS/c14-7-1-3-10(9(15)5-7)17-13(20)16-8-2-4-12-11(6-8)18-19-21-12/h1-6H,(H2,16,17,20) |
| InChIKey | HRLDDHFOKPRPLQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |